4-[4-(morpholin-4-yl)-4-oxobutyl]-6-[(2,4,6-trimethylphenoxy)acetyl]-2H-1,4-benzoxazin-3(4H)-one
Chemical Structure Depiction of
4-[4-(morpholin-4-yl)-4-oxobutyl]-6-[(2,4,6-trimethylphenoxy)acetyl]-2H-1,4-benzoxazin-3(4H)-one
4-[4-(morpholin-4-yl)-4-oxobutyl]-6-[(2,4,6-trimethylphenoxy)acetyl]-2H-1,4-benzoxazin-3(4H)-one
Compound characteristics
| Compound ID: | V018-5738 |
| Compound Name: | 4-[4-(morpholin-4-yl)-4-oxobutyl]-6-[(2,4,6-trimethylphenoxy)acetyl]-2H-1,4-benzoxazin-3(4H)-one |
| Molecular Weight: | 480.56 |
| Molecular Formula: | C27 H32 N2 O6 |
| Smiles: | Cc1cc(C)c(c(C)c1)OCC(c1ccc2c(c1)N(CCCC(N1CCOCC1)=O)C(CO2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7757 |
| logD: | 2.7757 |
| logSw: | -3.0523 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 68.995 |
| InChI Key: | WYTSPKZDIHTXSD-UHFFFAOYSA-N |