N-({5-[cyclohexyl(methyl)amino]-3-phenyl-1,2-oxazol-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide
Chemical Structure Depiction of
N-({5-[cyclohexyl(methyl)amino]-3-phenyl-1,2-oxazol-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide
N-({5-[cyclohexyl(methyl)amino]-3-phenyl-1,2-oxazol-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | V018-6672 |
| Compound Name: | N-({5-[cyclohexyl(methyl)amino]-3-phenyl-1,2-oxazol-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide |
| Molecular Weight: | 437.54 |
| Molecular Formula: | C25 H31 N3 O4 |
| Salt: | not_available |
| Smiles: | CN(C1CCCCC1)c1c(CN(CCOC)C(c2ccco2)=O)c(c2ccccc2)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.0253 |
| logD: | 4.0253 |
| logSw: | -3.9614 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.201 |
| InChI Key: | ZWPXZHMBZGEQGT-UHFFFAOYSA-N |