N-(2-methoxyethyl)-3-(3-methoxyphenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-3-(3-methoxyphenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide
N-(2-methoxyethyl)-3-(3-methoxyphenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide
Compound characteristics
| Compound ID: | V018-6808 |
| Compound Name: | N-(2-methoxyethyl)-3-(3-methoxyphenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide |
| Molecular Weight: | 463.5 |
| Molecular Formula: | C24 H28 F3 N3 O3 |
| Salt: | not_available |
| Smiles: | COCCNC(C1Cc2cc(ccc2N2CCN(CC12)c1cccc(c1)OC)C(F)(F)F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.0082 |
| logD: | 4.0078 |
| logSw: | -4.1383 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.216 |
| InChI Key: | RZJHMQYUXZOSSA-UHFFFAOYSA-N |