N-cyclopropyl-N'-ethyl-N-({2-[(2-fluorophenyl)methanesulfonyl]-1-[(oxolan-2-yl)methyl]-1H-imidazol-5-yl}methyl)urea
Chemical Structure Depiction of
N-cyclopropyl-N'-ethyl-N-({2-[(2-fluorophenyl)methanesulfonyl]-1-[(oxolan-2-yl)methyl]-1H-imidazol-5-yl}methyl)urea
N-cyclopropyl-N'-ethyl-N-({2-[(2-fluorophenyl)methanesulfonyl]-1-[(oxolan-2-yl)methyl]-1H-imidazol-5-yl}methyl)urea
Compound characteristics
| Compound ID: | V018-6816 |
| Compound Name: | N-cyclopropyl-N'-ethyl-N-({2-[(2-fluorophenyl)methanesulfonyl]-1-[(oxolan-2-yl)methyl]-1H-imidazol-5-yl}methyl)urea |
| Molecular Weight: | 464.56 |
| Molecular Formula: | C22 H29 F N4 O4 S |
| Salt: | not_available |
| Smiles: | CCNC(N(Cc1cnc(n1CC1CCCO1)S(Cc1ccccc1F)(=O)=O)C1CC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6607 |
| logD: | 2.6607 |
| logSw: | -2.8097 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.861 |
| InChI Key: | WYBYZXRHTOOVPU-LJQANCHMSA-N |