3-(2,4-difluorophenyl)-7-[(2-methylphenyl)methyl]-1-[(oxolan-2-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
3-(2,4-difluorophenyl)-7-[(2-methylphenyl)methyl]-1-[(oxolan-2-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione
3-(2,4-difluorophenyl)-7-[(2-methylphenyl)methyl]-1-[(oxolan-2-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | V018-6858 |
| Compound Name: | 3-(2,4-difluorophenyl)-7-[(2-methylphenyl)methyl]-1-[(oxolan-2-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 452.46 |
| Molecular Formula: | C24 H22 F2 N4 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccccc1Cn1cnc2c1C(N(CC1CCCO1)C(N2c1ccc(cc1F)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2308 |
| logD: | 3.2308 |
| logSw: | -3.2476 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.628 |
| InChI Key: | UWEVNWVIIPNQCO-GOSISDBHSA-N |