4-(3-methylphenyl)-3-oxo-N-[4-(trifluoromethyl)phenyl]-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide
Chemical Structure Depiction of
4-(3-methylphenyl)-3-oxo-N-[4-(trifluoromethyl)phenyl]-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide
4-(3-methylphenyl)-3-oxo-N-[4-(trifluoromethyl)phenyl]-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide
Compound characteristics
| Compound ID: | V018-7161 |
| Compound Name: | 4-(3-methylphenyl)-3-oxo-N-[4-(trifluoromethyl)phenyl]-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
| Molecular Weight: | 449.49 |
| Molecular Formula: | C22 H22 F3 N3 O2 S |
| Smiles: | Cc1cccc(c1)N1C(CSC12CCN(CC2)C(Nc1ccc(cc1)C(F)(F)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.31 |
| logD: | 4.31 |
| logSw: | -4.2231 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.389 |
| InChI Key: | GZXBNEMYXHZTSB-UHFFFAOYSA-N |