N-[2-(4-fluorobenzamido)ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-[2-(4-fluorobenzamido)ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide
N-[2-(4-fluorobenzamido)ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V018-7170 |
| Compound Name: | N-[2-(4-fluorobenzamido)ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 413.47 |
| Molecular Formula: | C21 H20 F N3 O3 S |
| Smiles: | Cc1ccc(cc1)OCc1nc(cs1)C(NCCNC(c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1238 |
| logD: | 3.1238 |
| logSw: | -3.3079 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.748 |
| InChI Key: | NKUKMSDECDPRST-UHFFFAOYSA-N |