2-[(2-methoxyphenoxy)methyl]-N-{2-[3-(trifluoromethyl)benzamido]ethyl}-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-[(2-methoxyphenoxy)methyl]-N-{2-[3-(trifluoromethyl)benzamido]ethyl}-1,3-thiazole-4-carboxamide
2-[(2-methoxyphenoxy)methyl]-N-{2-[3-(trifluoromethyl)benzamido]ethyl}-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V018-7597 |
| Compound Name: | 2-[(2-methoxyphenoxy)methyl]-N-{2-[3-(trifluoromethyl)benzamido]ethyl}-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 479.48 |
| Molecular Formula: | C22 H20 F3 N3 O4 S |
| Smiles: | COc1ccccc1OCc1nc(cs1)C(NCCNC(c1cccc(c1)C(F)(F)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2219 |
| logD: | 3.2219 |
| logSw: | -3.5916 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.465 |
| InChI Key: | DIQCTUBWFZOYFL-UHFFFAOYSA-N |