N-({2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(propan-2-yl)cyclopropanecarboxamide
Chemical Structure Depiction of
N-({2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(propan-2-yl)cyclopropanecarboxamide
N-({2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(propan-2-yl)cyclopropanecarboxamide
Compound characteristics
| Compound ID: | V018-7920 |
| Compound Name: | N-({2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(propan-2-yl)cyclopropanecarboxamide |
| Molecular Weight: | 399.34 |
| Molecular Formula: | C18 H20 Cl2 N2 O2 S |
| Smiles: | CC(C)N(Cc1csc(COc2cc(ccc2[Cl])[Cl])n1)C(C1CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3457 |
| logD: | 5.3457 |
| logSw: | -5.8988 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.027 |
| InChI Key: | UZIHIBIIYNLELV-UHFFFAOYSA-N |