N-cyclohexyl-5-(furan-2-yl)-1-propyl-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-5-(furan-2-yl)-1-propyl-1H-pyrazole-3-carboxamide
N-cyclohexyl-5-(furan-2-yl)-1-propyl-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | V018-9361 |
| Compound Name: | N-cyclohexyl-5-(furan-2-yl)-1-propyl-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 301.39 |
| Molecular Formula: | C17 H23 N3 O2 |
| Smiles: | CCCn1c(cc(C(NC2CCCCC2)=O)n1)c1ccco1 |
| Stereo: | ACHIRAL |
| logP: | 3.3978 |
| logD: | 3.3978 |
| logSw: | -3.6441 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.892 |
| InChI Key: | WQABBHXNBRXEBG-UHFFFAOYSA-N |