N-(2-methylbutyl)-2-[4-(3-phenylpropanamido)piperidin-1-yl]benzamide
Chemical Structure Depiction of
N-(2-methylbutyl)-2-[4-(3-phenylpropanamido)piperidin-1-yl]benzamide
N-(2-methylbutyl)-2-[4-(3-phenylpropanamido)piperidin-1-yl]benzamide
Compound characteristics
| Compound ID: | V018-9556 |
| Compound Name: | N-(2-methylbutyl)-2-[4-(3-phenylpropanamido)piperidin-1-yl]benzamide |
| Molecular Weight: | 421.58 |
| Molecular Formula: | C26 H35 N3 O2 |
| Salt: | not_available |
| Smiles: | CCC(C)CNC(c1ccccc1N1CCC(CC1)NC(CCc1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9555 |
| logD: | 4.9554 |
| logSw: | -4.5673 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.808 |
| InChI Key: | JCTWEHCCSIMYRC-FQEVSTJZSA-N |