5-({6-[(3-chlorophenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide
Chemical Structure Depiction of
5-({6-[(3-chlorophenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide
5-({6-[(3-chlorophenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | V018-9649 |
| Compound Name: | 5-({6-[(3-chlorophenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)-N-(2-methoxyethyl)furan-2-carboxamide |
| Molecular Weight: | 498.92 |
| Molecular Formula: | C25 H23 Cl N2 O7 |
| Smiles: | COCCNC(c1ccc(CN2C(COc3ccc(cc23)C(COc2cccc(c2)[Cl])=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2029 |
| logD: | 3.2029 |
| logSw: | -3.6197 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.253 |
| InChI Key: | SMPNBCURYXMTMA-UHFFFAOYSA-N |