{1-(cyclopropanecarbonyl)-6-[3-(trifluoromethyl)phenyl]piperidin-3-yl}(morpholin-4-yl)methanone
Chemical Structure Depiction of
{1-(cyclopropanecarbonyl)-6-[3-(trifluoromethyl)phenyl]piperidin-3-yl}(morpholin-4-yl)methanone
{1-(cyclopropanecarbonyl)-6-[3-(trifluoromethyl)phenyl]piperidin-3-yl}(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | V018-9962 |
| Compound Name: | {1-(cyclopropanecarbonyl)-6-[3-(trifluoromethyl)phenyl]piperidin-3-yl}(morpholin-4-yl)methanone |
| Molecular Weight: | 410.44 |
| Molecular Formula: | C21 H25 F3 N2 O3 |
| Smiles: | C1CC(c2cccc(c2)C(F)(F)F)N(CC1C(N1CCOCC1)=O)C(C1CC1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.2134 |
| logD: | 3.2134 |
| logSw: | -3.1584 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.323 |
| InChI Key: | LPQFPVPSDUDCAM-UHFFFAOYSA-N |