N-[3-(4-chlorophenyl)-1-(4-methylphenyl)-1H-pyrazol-5-yl]-2-phenylbutanamide
Chemical Structure Depiction of
N-[3-(4-chlorophenyl)-1-(4-methylphenyl)-1H-pyrazol-5-yl]-2-phenylbutanamide
N-[3-(4-chlorophenyl)-1-(4-methylphenyl)-1H-pyrazol-5-yl]-2-phenylbutanamide
Compound characteristics
| Compound ID: | V019-0238 |
| Compound Name: | N-[3-(4-chlorophenyl)-1-(4-methylphenyl)-1H-pyrazol-5-yl]-2-phenylbutanamide |
| Molecular Weight: | 429.95 |
| Molecular Formula: | C26 H24 Cl N3 O |
| Smiles: | CCC(C(Nc1cc(c2ccc(cc2)[Cl])nn1c1ccc(C)cc1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.1953 |
| logD: | 7.1953 |
| logSw: | -6.3023 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.493 |
| InChI Key: | HFUVBOBNEHWGMP-HSZRJFAPSA-N |