5-(4-fluorophenyl)-N-[1-(naphthalen-1-yl)ethyl]thiophene-2-carboxamide
Chemical Structure Depiction of
5-(4-fluorophenyl)-N-[1-(naphthalen-1-yl)ethyl]thiophene-2-carboxamide
5-(4-fluorophenyl)-N-[1-(naphthalen-1-yl)ethyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V019-0302 |
| Compound Name: | 5-(4-fluorophenyl)-N-[1-(naphthalen-1-yl)ethyl]thiophene-2-carboxamide |
| Molecular Weight: | 375.46 |
| Molecular Formula: | C23 H18 F N O S |
| Smiles: | CC(c1cccc2ccccc12)NC(c1ccc(c2ccc(cc2)F)s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.331 |
| logD: | 6.331 |
| logSw: | -6.8633 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.2902 |
| InChI Key: | WAECDAHHQDSMFX-HNNXBMFYSA-N |