N-(2-{[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]amino}-2-oxoethyl)-4-fluoro-N-(2-methoxyethyl)benzamide
Chemical Structure Depiction of
N-(2-{[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]amino}-2-oxoethyl)-4-fluoro-N-(2-methoxyethyl)benzamide
N-(2-{[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]amino}-2-oxoethyl)-4-fluoro-N-(2-methoxyethyl)benzamide
Compound characteristics
| Compound ID: | V019-1613 |
| Compound Name: | N-(2-{[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]amino}-2-oxoethyl)-4-fluoro-N-(2-methoxyethyl)benzamide |
| Molecular Weight: | 480.58 |
| Molecular Formula: | C27 H33 F N4 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(c(C)c1)n1c(cc(C(C)(C)C)n1)NC(CN(CCOC)C(c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2239 |
| logD: | 5.2236 |
| logSw: | -5.0302 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.054 |
| InChI Key: | KXUZKKSSCFSINF-UHFFFAOYSA-N |