ethyl 6-{[cyclohexyl(methyl)amino]methyl}-4-(2,3-dichlorophenyl)-1-ethyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 6-{[cyclohexyl(methyl)amino]methyl}-4-(2,3-dichlorophenyl)-1-ethyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 6-{[cyclohexyl(methyl)amino]methyl}-4-(2,3-dichlorophenyl)-1-ethyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | V019-2277 |
| Compound Name: | ethyl 6-{[cyclohexyl(methyl)amino]methyl}-4-(2,3-dichlorophenyl)-1-ethyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 468.42 |
| Molecular Formula: | C23 H31 Cl2 N3 O3 |
| Salt: | not_available |
| Smiles: | CCN1C(CN(C)C2CCCCC2)=C(C(c2cccc(c2[Cl])[Cl])NC1=O)C(=O)OCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2231 |
| logD: | 1.9586 |
| logSw: | -5.6247 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.537 |
| InChI Key: | KOKKJIZHJFAVCD-NRFANRHFSA-N |