1-(2-methylphenoxy)-3-{(2-methylpropyl)[(5-methylthiophen-2-yl)methyl]amino}propan-2-ol
Chemical Structure Depiction of
1-(2-methylphenoxy)-3-{(2-methylpropyl)[(5-methylthiophen-2-yl)methyl]amino}propan-2-ol
1-(2-methylphenoxy)-3-{(2-methylpropyl)[(5-methylthiophen-2-yl)methyl]amino}propan-2-ol
Compound characteristics
| Compound ID: | V019-2622 |
| Compound Name: | 1-(2-methylphenoxy)-3-{(2-methylpropyl)[(5-methylthiophen-2-yl)methyl]amino}propan-2-ol |
| Molecular Weight: | 347.52 |
| Molecular Formula: | C20 H29 N O2 S |
| Salt: | not_available |
| Smiles: | CC(C)CN(CC(COc1ccccc1C)O)Cc1ccc(C)s1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3603 |
| logD: | 4.1232 |
| logSw: | -5.4199 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.1738 |
| InChI Key: | RKDBLTLAUUYWFF-SFHVURJKSA-N |