ethyl 4-(3,4-dimethoxyphenyl)-6-{[4-(4-fluorobenzoyl)piperazin-1-yl]methyl}-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 4-(3,4-dimethoxyphenyl)-6-{[4-(4-fluorobenzoyl)piperazin-1-yl]methyl}-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 4-(3,4-dimethoxyphenyl)-6-{[4-(4-fluorobenzoyl)piperazin-1-yl]methyl}-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | V019-3749 |
| Compound Name: | ethyl 4-(3,4-dimethoxyphenyl)-6-{[4-(4-fluorobenzoyl)piperazin-1-yl]methyl}-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 540.59 |
| Molecular Formula: | C28 H33 F N4 O6 |
| Salt: | not_available |
| Smiles: | CCOC(C1C(c2ccc(c(c2)OC)OC)NC(N(C)C=1CN1CCN(CC1)C(c1ccc(cc1)F)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0123 |
| logD: | 1.4808 |
| logSw: | -2.7705 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.24 |
| InChI Key: | RGJPPZAGQIPTFP-RUZDIDTESA-N |