N~2~-(cyclopropylmethyl)-N-(1,4-diphenyl-1H-imidazol-2-yl)-N~2~-(4-methoxybenzene-1-sulfonyl)glycinamide
Chemical Structure Depiction of
N~2~-(cyclopropylmethyl)-N-(1,4-diphenyl-1H-imidazol-2-yl)-N~2~-(4-methoxybenzene-1-sulfonyl)glycinamide
N~2~-(cyclopropylmethyl)-N-(1,4-diphenyl-1H-imidazol-2-yl)-N~2~-(4-methoxybenzene-1-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | V019-3867 |
| Compound Name: | N~2~-(cyclopropylmethyl)-N-(1,4-diphenyl-1H-imidazol-2-yl)-N~2~-(4-methoxybenzene-1-sulfonyl)glycinamide |
| Molecular Weight: | 516.62 |
| Molecular Formula: | C28 H28 N4 O4 S |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1)S(N(CC1CC1)CC(Nc1nc(cn1c1ccccc1)c1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4383 |
| logD: | 5.4383 |
| logSw: | -5.2983 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.624 |
| InChI Key: | LRZPVQDTFQFNGB-UHFFFAOYSA-N |