2-fluoro-N-(2-{[1-(3-fluoro-4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]benzamide
Chemical Structure Depiction of
2-fluoro-N-(2-{[1-(3-fluoro-4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]benzamide
2-fluoro-N-(2-{[1-(3-fluoro-4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | V019-4147 |
| Compound Name: | 2-fluoro-N-(2-{[1-(3-fluoro-4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]benzamide |
| Molecular Weight: | 530.57 |
| Molecular Formula: | C30 H28 F2 N4 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1F)n1cc(c2ccccc2)nc1NC(CN(CC1CCCO1)C(c1ccccc1F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3102 |
| logD: | 5.3102 |
| logSw: | -5.1458 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.047 |
| InChI Key: | MYWOTWDEQPMSMM-HSZRJFAPSA-N |