N-(butan-2-yl)-2-({[(4-ethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}methyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-(butan-2-yl)-2-({[(4-ethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}methyl)-1,3-oxazole-4-carboxamide
N-(butan-2-yl)-2-({[(4-ethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}methyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V019-4859 |
| Compound Name: | N-(butan-2-yl)-2-({[(4-ethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}methyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 439.53 |
| Molecular Formula: | C25 H30 F N3 O3 |
| Salt: | not_available |
| Smiles: | CCC(C)NC(c1coc(CN(Cc2ccc(cc2)OCC)Cc2ccc(cc2)F)n1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9366 |
| logD: | 3.9366 |
| logSw: | -3.8713 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.334 |
| InChI Key: | SBEUFFCKIFNQRE-SFHVURJKSA-N |