[2-({benzyl[(4-methylphenyl)methyl]amino}methyl)-1,3-oxazol-4-yl](morpholin-4-yl)methanone
Chemical Structure Depiction of
[2-({benzyl[(4-methylphenyl)methyl]amino}methyl)-1,3-oxazol-4-yl](morpholin-4-yl)methanone
[2-({benzyl[(4-methylphenyl)methyl]amino}methyl)-1,3-oxazol-4-yl](morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | V019-5753 |
| Compound Name: | [2-({benzyl[(4-methylphenyl)methyl]amino}methyl)-1,3-oxazol-4-yl](morpholin-4-yl)methanone |
| Molecular Weight: | 405.5 |
| Molecular Formula: | C24 H27 N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN(Cc2ccccc2)Cc2nc(co2)C(N2CCOCC2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.0839 |
| logD: | 3.0838 |
| logSw: | -2.9154 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.641 |
| InChI Key: | SZSGCHLHLWSSNH-UHFFFAOYSA-N |