N-(4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)cyclobutanecarboxamide
Chemical Structure Depiction of
N-(4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)cyclobutanecarboxamide
N-(4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)cyclobutanecarboxamide
Compound characteristics
| Compound ID: | V019-5827 |
| Compound Name: | N-(4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)cyclobutanecarboxamide |
| Molecular Weight: | 397.9 |
| Molecular Formula: | C22 H24 Cl N3 O2 |
| Smiles: | C1CC(C1)C(Nc1ccc(cc1)N1CCCN(Cc2ccc(cc2)[Cl])C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4757 |
| logD: | 3.4757 |
| logSw: | -3.8164 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.411 |
| InChI Key: | SNJWGTSSZFIESG-UHFFFAOYSA-N |