N-cyclopropyl-N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-4-fluorobenzamide
Chemical Structure Depiction of
N-cyclopropyl-N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-4-fluorobenzamide
N-cyclopropyl-N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-4-fluorobenzamide
Compound characteristics
| Compound ID: | V019-7980 |
| Compound Name: | N-cyclopropyl-N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-4-fluorobenzamide |
| Molecular Weight: | 454.5 |
| Molecular Formula: | C27 H23 F N4 O2 |
| Salt: | not_available |
| Smiles: | C1CC1N(CC(Nc1nc(cn1c1ccccc1)c1ccccc1)=O)C(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2412 |
| logD: | 5.2412 |
| logSw: | -5.3476 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.969 |
| InChI Key: | PLZUVXUEGUWAKP-UHFFFAOYSA-N |