2-[(benzyl{[2-(trifluoromethyl)phenyl]methyl}amino)methyl]-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
2-[(benzyl{[2-(trifluoromethyl)phenyl]methyl}amino)methyl]-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide
2-[(benzyl{[2-(trifluoromethyl)phenyl]methyl}amino)methyl]-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V019-8608 |
| Compound Name: | 2-[(benzyl{[2-(trifluoromethyl)phenyl]methyl}amino)methyl]-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 497.49 |
| Molecular Formula: | C27 H23 F4 N3 O2 |
| Salt: | not_available |
| Smiles: | C(c1ccc(cc1)F)NC(c1coc(CN(Cc2ccccc2)Cc2ccccc2C(F)(F)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2672 |
| logD: | 5.2672 |
| logSw: | -5.4713 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.498 |
| InChI Key: | NYNBXLPOLDJWMO-UHFFFAOYSA-N |