N-[2-(dimethylamino)ethyl]-4-methoxy-N-(2-{[4-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)benzamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-4-methoxy-N-(2-{[4-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)benzamide
N-[2-(dimethylamino)ethyl]-4-methoxy-N-(2-{[4-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | V020-0608 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-4-methoxy-N-(2-{[4-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)benzamide |
| Molecular Weight: | 541.65 |
| Molecular Formula: | C31 H35 N5 O4 |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)n1cc(c2ccc(cc2)OC)nc1NC(CN(CCN(C)C)C(c1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8467 |
| logD: | 4.3796 |
| logSw: | -4.3746 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.596 |
| InChI Key: | PWRQSERJVURNAX-UHFFFAOYSA-N |