propan-2-yl 5-(2-fluorophenyl)-7-methyl-3-{2-oxo-2-[(propan-2-yl)amino]ethyl}-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Chemical Structure Depiction of
propan-2-yl 5-(2-fluorophenyl)-7-methyl-3-{2-oxo-2-[(propan-2-yl)amino]ethyl}-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
propan-2-yl 5-(2-fluorophenyl)-7-methyl-3-{2-oxo-2-[(propan-2-yl)amino]ethyl}-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | V020-1406 |
| Compound Name: | propan-2-yl 5-(2-fluorophenyl)-7-methyl-3-{2-oxo-2-[(propan-2-yl)amino]ethyl}-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| Molecular Weight: | 431.53 |
| Molecular Formula: | C22 H26 F N3 O3 S |
| Smiles: | CC(C)NC(CC1=CSC2=NC(C)=C(C(c3ccccc3F)N12)C(=O)OC(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8238 |
| logD: | 3.8214 |
| logSw: | -3.9841 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.535 |
| InChI Key: | WLXGHQCINSZVOC-FQEVSTJZSA-N |