4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(3-methylthiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
Chemical Structure Depiction of
4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(3-methylthiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(3-methylthiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
Compound characteristics
| Compound ID: | V020-3373 |
| Compound Name: | 4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(3-methylthiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| Molecular Weight: | 452.59 |
| Molecular Formula: | C25 H29 F N4 O S |
| Salt: | not_available |
| Smiles: | CC1CCN(CC1)c1nc2CCN(Cc2c(n1)Oc1ccccc1F)Cc1c(C)ccs1 |
| Stereo: | ACHIRAL |
| logP: | 6.2126 |
| logD: | 6.212 |
| logSw: | -5.7551 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.695 |
| InChI Key: | ZTQXWKOYWGUPHQ-UHFFFAOYSA-N |