3-chloro-N-(2-{3-[(3,5-dimethoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-5-methylphenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
3-chloro-N-(2-{3-[(3,5-dimethoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-5-methylphenyl)benzene-1-sulfonamide
3-chloro-N-(2-{3-[(3,5-dimethoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-5-methylphenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | V020-3652 |
| Compound Name: | 3-chloro-N-(2-{3-[(3,5-dimethoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-5-methylphenyl)benzene-1-sulfonamide |
| Molecular Weight: | 530.04 |
| Molecular Formula: | C26 H28 Cl N3 O5 S |
| Smiles: | Cc1ccc(c(c1)NS(c1cccc(c1)[Cl])(=O)=O)N1CCCN(Cc2cc(cc(c2)OC)OC)C1=O |
| Stereo: | ACHIRAL |
| logP: | 5.0033 |
| logD: | 4.5476 |
| logSw: | -4.9525 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.535 |
| InChI Key: | OTBDMVNPVIVHMW-UHFFFAOYSA-N |