methyl 3-[2-(benzylamino)-2-oxoethyl]-7-ethyl-5-(2-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Chemical Structure Depiction of
methyl 3-[2-(benzylamino)-2-oxoethyl]-7-ethyl-5-(2-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
methyl 3-[2-(benzylamino)-2-oxoethyl]-7-ethyl-5-(2-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | V020-3858 |
| Compound Name: | methyl 3-[2-(benzylamino)-2-oxoethyl]-7-ethyl-5-(2-methoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| Molecular Weight: | 477.58 |
| Molecular Formula: | C26 H27 N3 O4 S |
| Smiles: | CCC1=C(C(c2ccccc2OC)N2C(CC(NCc3ccccc3)=O)=CSC2=N1)C(=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1957 |
| logD: | 4.1946 |
| logSw: | -4.3134 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.268 |
| InChI Key: | SVYWWUKVQHNUOR-XMMPIXPASA-N |