2-chloro-N-[4-(2-oxo-3-{[4-(trifluoromethyl)phenyl]methyl}-1,3-diazinan-1-yl)phenyl]benzamide
Chemical Structure Depiction of
2-chloro-N-[4-(2-oxo-3-{[4-(trifluoromethyl)phenyl]methyl}-1,3-diazinan-1-yl)phenyl]benzamide
2-chloro-N-[4-(2-oxo-3-{[4-(trifluoromethyl)phenyl]methyl}-1,3-diazinan-1-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | V020-4600 |
| Compound Name: | 2-chloro-N-[4-(2-oxo-3-{[4-(trifluoromethyl)phenyl]methyl}-1,3-diazinan-1-yl)phenyl]benzamide |
| Molecular Weight: | 487.91 |
| Molecular Formula: | C25 H21 Cl F3 N3 O2 |
| Smiles: | C1CN(Cc2ccc(cc2)C(F)(F)F)C(N(C1)c1ccc(cc1)NC(c1ccccc1[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5759 |
| logD: | 5.5749 |
| logSw: | -5.7835 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.888 |
| InChI Key: | NLPBDZNGIBCIDY-UHFFFAOYSA-N |