N-[(furan-2-yl)methyl]-3-methyl-N-{[3-phenyl-5-(piperidin-1-yl)-1,2-oxazol-4-yl]methyl}butanamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-3-methyl-N-{[3-phenyl-5-(piperidin-1-yl)-1,2-oxazol-4-yl]methyl}butanamide
N-[(furan-2-yl)methyl]-3-methyl-N-{[3-phenyl-5-(piperidin-1-yl)-1,2-oxazol-4-yl]methyl}butanamide
Compound characteristics
| Compound ID: | V020-5011 |
| Compound Name: | N-[(furan-2-yl)methyl]-3-methyl-N-{[3-phenyl-5-(piperidin-1-yl)-1,2-oxazol-4-yl]methyl}butanamide |
| Molecular Weight: | 421.54 |
| Molecular Formula: | C25 H31 N3 O3 |
| Smiles: | CC(C)CC(N(Cc1c(c2ccccc2)noc1N1CCCCC1)Cc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.952 |
| logD: | 4.952 |
| logSw: | -4.5362 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.969 |
| InChI Key: | ZFTPBIZSXZCUBL-UHFFFAOYSA-N |