[4-(7-methyldibenzo[b,f][1,4]oxazepin-11-yl)piperazin-1-yl](thiophen-2-yl)methanone
Chemical Structure Depiction of
[4-(7-methyldibenzo[b,f][1,4]oxazepin-11-yl)piperazin-1-yl](thiophen-2-yl)methanone
[4-(7-methyldibenzo[b,f][1,4]oxazepin-11-yl)piperazin-1-yl](thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | V020-6484 |
| Compound Name: | [4-(7-methyldibenzo[b,f][1,4]oxazepin-11-yl)piperazin-1-yl](thiophen-2-yl)methanone |
| Molecular Weight: | 403.5 |
| Molecular Formula: | C23 H21 N3 O2 S |
| Salt: | not_available |
| Smiles: | Cc1ccc2c(c1)Oc1ccccc1C(=N2)N1CCN(CC1)C(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2909 |
| logD: | 3.5651 |
| logSw: | -4.4238 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.736 |
| InChI Key: | SAQCOGPIUPQMDH-UHFFFAOYSA-N |