methyl 4-[N-cyclohexyl-N-(thiophene-2-carbonyl)glycyl]-1-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 4-[N-cyclohexyl-N-(thiophene-2-carbonyl)glycyl]-1-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
methyl 4-[N-cyclohexyl-N-(thiophene-2-carbonyl)glycyl]-1-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | V020-6796 |
| Compound Name: | methyl 4-[N-cyclohexyl-N-(thiophene-2-carbonyl)glycyl]-1-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 430.57 |
| Molecular Formula: | C23 H30 N2 O4 S |
| Smiles: | CCn1c(C)c(C(CN(C2CCCCC2)C(c2cccs2)=O)=O)c(C)c1C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.4149 |
| logD: | 4.4149 |
| logSw: | -4.3495 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.585 |
| InChI Key: | DKHUIFHETUFYLA-UHFFFAOYSA-N |