2-bromo-4-[(4-methoxyphenyl)methyl]-N-[(pyridin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Chemical Structure Depiction of
2-bromo-4-[(4-methoxyphenyl)methyl]-N-[(pyridin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
2-bromo-4-[(4-methoxyphenyl)methyl]-N-[(pyridin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Compound characteristics
| Compound ID: | V020-7682 |
| Compound Name: | 2-bromo-4-[(4-methoxyphenyl)methyl]-N-[(pyridin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| Molecular Weight: | 456.36 |
| Molecular Formula: | C21 H18 Br N3 O2 S |
| Salt: | not_available |
| Smiles: | COc1ccc(Cn2c(cc3c2cc(s3)[Br])C(NCc2ccncc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.1024 |
| logD: | 4.099 |
| logSw: | -4.2041 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.096 |
| InChI Key: | XFPNWQJJTDLQRP-UHFFFAOYSA-N |