4-(2-methylphenyl)-1-(4-methylphenyl)-8-[2-(morpholin-4-yl)-2-oxoethyl]-3-phenyl-4,8-dihydro-1H-pyrazolo[3,4-e][1,4]thiazepin-7(6H)-one
Chemical Structure Depiction of
4-(2-methylphenyl)-1-(4-methylphenyl)-8-[2-(morpholin-4-yl)-2-oxoethyl]-3-phenyl-4,8-dihydro-1H-pyrazolo[3,4-e][1,4]thiazepin-7(6H)-one
4-(2-methylphenyl)-1-(4-methylphenyl)-8-[2-(morpholin-4-yl)-2-oxoethyl]-3-phenyl-4,8-dihydro-1H-pyrazolo[3,4-e][1,4]thiazepin-7(6H)-one
Compound characteristics
| Compound ID: | V020-7861 |
| Compound Name: | 4-(2-methylphenyl)-1-(4-methylphenyl)-8-[2-(morpholin-4-yl)-2-oxoethyl]-3-phenyl-4,8-dihydro-1H-pyrazolo[3,4-e][1,4]thiazepin-7(6H)-one |
| Molecular Weight: | 552.7 |
| Molecular Formula: | C32 H32 N4 O3 S |
| Smiles: | Cc1ccc(cc1)n1c2c(C(c3ccccc3C)SCC(N2CC(N2CCOCC2)=O)=O)c(c2ccccc2)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1424 |
| logD: | 5.1424 |
| logSw: | -4.942 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.326 |
| InChI Key: | PMIIGERLCYJMDE-WJOKGBTCSA-N |