N-benzyl-2-({[(3-methoxyphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-benzyl-2-({[(3-methoxyphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-1,3-oxazole-4-carboxamide
N-benzyl-2-({[(3-methoxyphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V020-9980 |
| Compound Name: | N-benzyl-2-({[(3-methoxyphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 421.54 |
| Molecular Formula: | C25 H31 N3 O3 |
| Smiles: | CC(C)C(C)N(Cc1cccc(c1)OC)Cc1nc(co1)C(NCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6779 |
| logD: | 4.6553 |
| logSw: | -4.4206 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.569 |
| InChI Key: | HTNGFDXIVIFVGP-IBGZPJMESA-N |