4-{4-[(cyclopropanecarbonyl)amino]phenyl}-1-(2-methylphenyl)-3-(3-methylphenyl)-1H-pyrazol-5-yl acetate
Chemical Structure Depiction of
4-{4-[(cyclopropanecarbonyl)amino]phenyl}-1-(2-methylphenyl)-3-(3-methylphenyl)-1H-pyrazol-5-yl acetate
4-{4-[(cyclopropanecarbonyl)amino]phenyl}-1-(2-methylphenyl)-3-(3-methylphenyl)-1H-pyrazol-5-yl acetate
Compound characteristics
| Compound ID: | V021-0345 |
| Compound Name: | 4-{4-[(cyclopropanecarbonyl)amino]phenyl}-1-(2-methylphenyl)-3-(3-methylphenyl)-1H-pyrazol-5-yl acetate |
| Molecular Weight: | 465.55 |
| Molecular Formula: | C29 H27 N3 O3 |
| Smiles: | CC(=O)Oc1c(c2ccc(cc2)NC(C2CC2)=O)c(c2cccc(C)c2)nn1c1ccccc1C |
| Stereo: | ACHIRAL |
| logP: | 6.116 |
| logD: | 6.116 |
| logSw: | -5.5351 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.887 |
| InChI Key: | ORBMKAMFTAJPHT-UHFFFAOYSA-N |