N-(3-methoxyphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-(3-methoxyphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}thiophene-2-carboxamide
N-(3-methoxyphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V021-1180 |
| Compound Name: | N-(3-methoxyphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}thiophene-2-carboxamide |
| Molecular Weight: | 451.54 |
| Molecular Formula: | C24 H25 N3 O4 S |
| Salt: | not_available |
| Smiles: | COc1cccc(c1)N(C1CCN(CC1)Cc1cccc(c1)[N+]([O-])=O)C(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.859 |
| logD: | 4.6908 |
| logSw: | -4.7043 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.426 |
| InChI Key: | KMBSJNHPWPPYNZ-UHFFFAOYSA-N |