N-benzyl-3-(2,4-dimethoxyphenyl)-1-ethyl-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
N-benzyl-3-(2,4-dimethoxyphenyl)-1-ethyl-1H-pyrazole-5-carboxamide
N-benzyl-3-(2,4-dimethoxyphenyl)-1-ethyl-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | V021-1629 |
| Compound Name: | N-benzyl-3-(2,4-dimethoxyphenyl)-1-ethyl-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C21 H23 N3 O3 |
| Salt: | not_available |
| Smiles: | CCn1c(cc(c2ccc(cc2OC)OC)n1)C(NCc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4191 |
| logD: | 3.4191 |
| logSw: | -3.819 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.509 |
| InChI Key: | SSICDABTPBKUDQ-UHFFFAOYSA-N |