4-(3-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(thiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
Chemical Structure Depiction of
4-(3-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(thiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
4-(3-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(thiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
Compound characteristics
| Compound ID: | V021-2441 |
| Compound Name: | 4-(3-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-6-[(thiophen-2-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| Molecular Weight: | 438.57 |
| Molecular Formula: | C24 H27 F N4 O S |
| Salt: | not_available |
| Smiles: | CC1CCN(CC1)c1nc2CCN(Cc2c(n1)Oc1cccc(c1)F)Cc1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 5.8144 |
| logD: | 5.8134 |
| logSw: | -5.6773 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.608 |
| InChI Key: | ZCBUBYJRUYRXPE-UHFFFAOYSA-N |