2-(4-chlorophenyl)-4-(2-fluorophenyl)-N~6~-[(3-fluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine
Chemical Structure Depiction of
2-(4-chlorophenyl)-4-(2-fluorophenyl)-N~6~-[(3-fluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine
2-(4-chlorophenyl)-4-(2-fluorophenyl)-N~6~-[(3-fluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine
Compound characteristics
| Compound ID: | V021-3074 |
| Compound Name: | 2-(4-chlorophenyl)-4-(2-fluorophenyl)-N~6~-[(3-fluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| Molecular Weight: | 462.89 |
| Molecular Formula: | C24 H17 Cl F2 N6 |
| Salt: | not_available |
| Smiles: | C(c1cccc(c1)F)Nc1nc(c2ccccc2F)c2c(n1)nn(c1ccc(cc1)[Cl])c2N |
| Stereo: | ACHIRAL |
| logP: | 5.5557 |
| logD: | 5.5556 |
| logSw: | -6.3589 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.811 |
| InChI Key: | JJDSUJDLJVBLFH-UHFFFAOYSA-N |