N-[(4-methylphenyl)methyl]-N-(4-{2-oxo-2-[(propan-2-yl)amino]ethyl}phenyl)propanamide
Chemical Structure Depiction of
N-[(4-methylphenyl)methyl]-N-(4-{2-oxo-2-[(propan-2-yl)amino]ethyl}phenyl)propanamide
N-[(4-methylphenyl)methyl]-N-(4-{2-oxo-2-[(propan-2-yl)amino]ethyl}phenyl)propanamide
Compound characteristics
| Compound ID: | V021-4027 |
| Compound Name: | N-[(4-methylphenyl)methyl]-N-(4-{2-oxo-2-[(propan-2-yl)amino]ethyl}phenyl)propanamide |
| Molecular Weight: | 352.48 |
| Molecular Formula: | C22 H28 N2 O2 |
| Smiles: | CCC(N(Cc1ccc(C)cc1)c1ccc(CC(NC(C)C)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7519 |
| logD: | 3.7519 |
| logSw: | -3.8877 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.779 |
| InChI Key: | WRAGDFNIUSENRE-UHFFFAOYSA-N |