5-(4-cyclohexylphenyl)-N-methyl-N-propyl-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(4-cyclohexylphenyl)-N-methyl-N-propyl-1,2-oxazole-3-carboxamide
5-(4-cyclohexylphenyl)-N-methyl-N-propyl-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | V021-4075 |
| Compound Name: | 5-(4-cyclohexylphenyl)-N-methyl-N-propyl-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 326.44 |
| Molecular Formula: | C20 H26 N2 O2 |
| Smiles: | CCCN(C)C(c1cc(c2ccc(cc2)C2CCCCC2)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1853 |
| logD: | 5.1853 |
| logSw: | -5.0169 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.095 |
| InChI Key: | WMBVYORWUSMSLI-UHFFFAOYSA-N |