N-ethyl-4-{[4-(2-fluorophenyl)piperazin-1-yl]methyl}benzamide
Chemical Structure Depiction of
N-ethyl-4-{[4-(2-fluorophenyl)piperazin-1-yl]methyl}benzamide
N-ethyl-4-{[4-(2-fluorophenyl)piperazin-1-yl]methyl}benzamide
Compound characteristics
| Compound ID: | V021-5556 |
| Compound Name: | N-ethyl-4-{[4-(2-fluorophenyl)piperazin-1-yl]methyl}benzamide |
| Molecular Weight: | 341.43 |
| Molecular Formula: | C20 H24 F N3 O |
| Salt: | not_available |
| Smiles: | CCNC(c1ccc(CN2CCN(CC2)c2ccccc2F)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.577 |
| logD: | 2.5479 |
| logSw: | -2.8316 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.2411 |
| InChI Key: | JSJIQASGVSRXOA-UHFFFAOYSA-N |