2-(4-chlorophenyl)-3,5-dioxo-4-(1-phenylethyl)-N-(propan-2-yl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Chemical Structure Depiction of
2-(4-chlorophenyl)-3,5-dioxo-4-(1-phenylethyl)-N-(propan-2-yl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
2-(4-chlorophenyl)-3,5-dioxo-4-(1-phenylethyl)-N-(propan-2-yl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Compound characteristics
| Compound ID: | V021-8333 |
| Compound Name: | 2-(4-chlorophenyl)-3,5-dioxo-4-(1-phenylethyl)-N-(propan-2-yl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide |
| Molecular Weight: | 412.87 |
| Molecular Formula: | C21 H21 Cl N4 O3 |
| Salt: | not_available |
| Smiles: | CC(C)NC(C1C(N(C(C)c2ccccc2)C(N(c2ccc(cc2)[Cl])N=1)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7574 |
| logD: | 3.7573 |
| logSw: | -4.4159 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.245 |
| InChI Key: | GWNJGTHRPVRGJH-AWEZNQCLSA-N |