N-(4-ethylphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}benzamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}benzamide
N-(4-ethylphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}benzamide
Compound characteristics
| Compound ID: | V021-9458 |
| Compound Name: | N-(4-ethylphenyl)-N-{1-[(3-nitrophenyl)methyl]piperidin-4-yl}benzamide |
| Molecular Weight: | 443.55 |
| Molecular Formula: | C27 H29 N3 O3 |
| Salt: | not_available |
| Smiles: | CCc1ccc(cc1)N(C1CCN(CC1)Cc1cccc(c1)[N+]([O-])=O)C(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5086 |
| logD: | 5.3404 |
| logSw: | -5.418 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.864 |
| InChI Key: | DAAGKQSNGSSDJY-UHFFFAOYSA-N |