N-{2-(diethylamino)-1-[1-(4-methylbenzoyl)piperidin-4-yl]-2-oxoethyl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{2-(diethylamino)-1-[1-(4-methylbenzoyl)piperidin-4-yl]-2-oxoethyl}thiophene-2-carboxamide
N-{2-(diethylamino)-1-[1-(4-methylbenzoyl)piperidin-4-yl]-2-oxoethyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V021-9550 |
| Compound Name: | N-{2-(diethylamino)-1-[1-(4-methylbenzoyl)piperidin-4-yl]-2-oxoethyl}thiophene-2-carboxamide |
| Molecular Weight: | 441.59 |
| Molecular Formula: | C24 H31 N3 O3 S |
| Smiles: | CCN(CC)C(C(C1CCN(CC1)C(c1ccc(C)cc1)=O)NC(c1cccs1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2856 |
| logD: | 3.2856 |
| logSw: | -3.3714 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.603 |
| InChI Key: | CXDAGROAFRRLPC-NRFANRHFSA-N |