1-(3,4-dichlorophenyl)-2-[(2,6-difluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine
Chemical Structure Depiction of
1-(3,4-dichlorophenyl)-2-[(2,6-difluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine
1-(3,4-dichlorophenyl)-2-[(2,6-difluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine
Compound characteristics
| Compound ID: | V022-0151 |
| Compound Name: | 1-(3,4-dichlorophenyl)-2-[(2,6-difluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine |
| Molecular Weight: | 407.29 |
| Molecular Formula: | C21 H18 Cl2 F2 N2 |
| Smiles: | C1CN(Cc2c(cccc2F)F)C(c2ccc(c(c2)[Cl])[Cl])c2cccn2C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1032 |
| logD: | 6.1026 |
| logSw: | -6.7175 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 5.9418 |
| InChI Key: | ZTYIXXKVDPIIKE-OAQYLSRUSA-N |